C25H28N4OS — CID 92884205
(3S)-N-(4-ethylphenyl)-1-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]piperidine-3-carboxamide (PubChem CID 92884205) has the molecular formula C25H28N4OS and a molecular weight of 432.59 g/mol. Its IUPAC name is (3S)-N-(4-ethylphenyl)-1-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-(4-ethylphenyl)-1-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92884205 |
| Molecular Formula | C25H28N4OS |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | (3S)-N-(4-ethylphenyl)-1-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]piperidine-3-carboxamide |
| SMILES | CCc1ccc(NC(=O)[C@H]2CCCN(c3nccnc3Sc3ccc(C)cc3)C2)cc1 |
| InChI | InChI=1S/C25H28N4OS/c1-3-19-8-10-21(11-9-19)28-24(30)20-5-4-16-29(17-20)23-25(27-15-14-26-23)31-22-12-6-18(2)7-13-22/h6-15,20H,3-5,16-17H2,1-2H3,(H,28,30)/t20-/m0/s1 |
| InChIKey | XVRABJKBOSKAAI-FQEVSTJZSA-N |
| XLogP | 5.35 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |