C25H28N4O2 — CID 95050382
(3R)-N-(4-ethylphenyl)-1-[3-(4-methylphenoxy)pyrazin-2-yl]piperidine-3-carboxamide (PubChem CID 95050382) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is (3R)-N-(4-ethylphenyl)-1-[3-(4-methylphenoxy)pyrazin-2-yl]piperidine-3-carboxamide.
| Compound Name | (3R)-N-(4-ethylphenyl)-1-[3-(4-methylphenoxy)pyrazin-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95050382 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (3R)-N-(4-ethylphenyl)-1-[3-(4-methylphenoxy)pyrazin-2-yl]piperidine-3-carboxamide |
| SMILES | CCc1ccc(NC(=O)[C@@H]2CCCN(c3nccnc3Oc3ccc(C)cc3)C2)cc1 |
| InChI | InChI=1S/C25H28N4O2/c1-3-19-8-10-21(11-9-19)28-24(30)20-5-4-16-29(17-20)23-25(27-15-14-26-23)31-22-12-6-18(2)7-13-22/h6-15,20H,3-5,16-17H2,1-2H3,(H,28,30)/t20-/m1/s1 |
| InChIKey | XWYLJLONTBXTDC-HXUWFJFHSA-N |
| XLogP | 4.99 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |