C24H26N4O3 — CID 95050432
(3R)-N-(4-ethoxyphenyl)-1-(3-phenoxypyrazin-2-yl)piperidine-3-carboxamide (PubChem CID 95050432) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is (3R)-N-(4-ethoxyphenyl)-1-(3-phenoxypyrazin-2-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-(4-ethoxyphenyl)-1-(3-phenoxypyrazin-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95050432 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | (3R)-N-(4-ethoxyphenyl)-1-(3-phenoxypyrazin-2-yl)piperidine-3-carboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2CCCN(c3nccnc3Oc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C24H26N4O3/c1-2-30-20-12-10-19(11-13-20)27-23(29)18-7-6-16-28(17-18)22-24(26-15-14-25-22)31-21-8-4-3-5-9-21/h3-5,8-15,18H,2,6-7,16-17H2,1H3,(H,27,29)/t18-/m1/s1 |
| InChIKey | YBMBDNJZNAQRNI-GOSISDBHSA-N |
| XLogP | 4.52 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |