C26H30N4O4 — CID 92897300
(3S)-N-(2,5-diethoxyphenyl)-1-(3-phenoxypyrazin-2-yl)piperidine-3-carboxamide (PubChem CID 92897300) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is (3S)-N-(2,5-diethoxyphenyl)-1-(3-phenoxypyrazin-2-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-(2,5-diethoxyphenyl)-1-(3-phenoxypyrazin-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92897300 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | (3S)-N-(2,5-diethoxyphenyl)-1-(3-phenoxypyrazin-2-yl)piperidine-3-carboxamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)[C@H]2CCCN(c3nccnc3Oc3ccccc3)C2)c1 |
| InChI | InChI=1S/C26H30N4O4/c1-3-32-21-12-13-23(33-4-2)22(17-21)29-25(31)19-9-8-16-30(18-19)24-26(28-15-14-27-24)34-20-10-6-5-7-11-20/h5-7,10-15,17,19H,3-4,8-9,16,18H2,1-2H3,(H,29,31)/t19-/m0/s1 |
| InChIKey | KVBIUYUEQIECOD-IBGZPJMESA-N |
| XLogP | 4.92 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |