C26H30N4O4 — CID 46392125
N-(2,5-diethoxyphenyl)-1-(3-phenoxypyrazin-2-yl)piperidine-4-carboxamide (PubChem CID 46392125) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is N-(2,5-diethoxyphenyl)-1-(3-phenoxypyrazin-2-yl)piperidine-4-carboxamide.
| Compound Name | N-(2,5-diethoxyphenyl)-1-(3-phenoxypyrazin-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46392125 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | N-(2,5-diethoxyphenyl)-1-(3-phenoxypyrazin-2-yl)piperidine-4-carboxamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)C2CCN(c3nccnc3Oc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C26H30N4O4/c1-3-32-21-10-11-23(33-4-2)22(18-21)29-25(31)19-12-16-30(17-13-19)24-26(28-15-14-27-24)34-20-8-6-5-7-9-20/h5-11,14-15,18-19H,3-4,12-13,16-17H2,1-2H3,(H,29,31) |
| InChIKey | DLSWWKNQFIPANF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |