C25H28N4O2 — CID 46392153
N-[(4-ethylphenyl)methyl]-1-(3-phenoxypyrazin-2-yl)piperidine-4-carboxamide (PubChem CID 46392153) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is N-[(4-ethylphenyl)methyl]-1-(3-phenoxypyrazin-2-yl)piperidine-4-carboxamide.
| Compound Name | N-[(4-ethylphenyl)methyl]-1-(3-phenoxypyrazin-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46392153 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-[(4-ethylphenyl)methyl]-1-(3-phenoxypyrazin-2-yl)piperidine-4-carboxamide |
| SMILES | CCc1ccc(CNC(=O)C2CCN(c3nccnc3Oc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H28N4O2/c1-2-19-8-10-20(11-9-19)18-28-24(30)21-12-16-29(17-13-21)23-25(27-15-14-26-23)31-22-6-4-3-5-7-22/h3-11,14-15,21H,2,12-13,16-18H2,1H3,(H,28,30) |
| InChIKey | KEEWSNJZXASERC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |