C24H25BrN4O3 — CID 50834243
N-[(4-bromophenyl)methyl]-1-[3-(3-methoxyphenoxy)pyrazin-2-yl]piperidine-4-carboxamide (PubChem CID 50834243) has the molecular formula C24H25BrN4O3 and a molecular weight of 497.39 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-1-[3-(3-methoxyphenoxy)pyrazin-2-yl]piperidine-4-carboxamide.
| Compound Name | N-[(4-bromophenyl)methyl]-1-[3-(3-methoxyphenoxy)pyrazin-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 50834243 |
| Molecular Formula | C24H25BrN4O3 |
| Molecular Weight | 497.39 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-1-[3-(3-methoxyphenoxy)pyrazin-2-yl]piperidine-4-carboxamide |
| SMILES | COc1cccc(Oc2nccnc2N2CCC(C(=O)NCc3ccc(Br)cc3)CC2)c1 |
| InChI | InChI=1S/C24H25BrN4O3/c1-31-20-3-2-4-21(15-20)32-24-22(26-11-12-27-24)29-13-9-18(10-14-29)23(30)28-16-17-5-7-19(25)8-6-17/h2-8,11-12,15,18H,9-10,13-14,16H2,1H3,(H,28,30) |
| InChIKey | LFVXEXPEJPBGOD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |