C24H25FN4O4 — CID 50834387
N-(3-fluoro-4-methoxyphenyl)-1-[3-(3-methoxyphenoxy)pyrazin-2-yl]piperidine-4-carboxamide (PubChem CID 50834387) has the molecular formula C24H25FN4O4 and a molecular weight of 452.49 g/mol. Its IUPAC name is N-(3-fluoro-4-methoxyphenyl)-1-[3-(3-methoxyphenoxy)pyrazin-2-yl]piperidine-4-carboxamide.
| Compound Name | N-(3-fluoro-4-methoxyphenyl)-1-[3-(3-methoxyphenoxy)pyrazin-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 50834387 |
| Molecular Formula | C24H25FN4O4 |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | N-(3-fluoro-4-methoxyphenyl)-1-[3-(3-methoxyphenoxy)pyrazin-2-yl]piperidine-4-carboxamide |
| SMILES | COc1cccc(Oc2nccnc2N2CCC(C(=O)Nc3ccc(OC)c(F)c3)CC2)c1 |
| InChI | InChI=1S/C24H25FN4O4/c1-31-18-4-3-5-19(15-18)33-24-22(26-10-11-27-24)29-12-8-16(9-13-29)23(30)28-17-6-7-21(32-2)20(25)14-17/h3-7,10-11,14-16H,8-9,12-13H2,1-2H3,(H,28,30) |
| InChIKey | OBVSBJRRKFFORE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |