C26H31N5O2 — CID 46392089
N-[[4-(dimethylamino)phenyl]methyl]-1-[3-(4-methylphenoxy)pyrazin-2-yl]piperidine-4-carboxamide (PubChem CID 46392089) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-1-[3-(4-methylphenoxy)pyrazin-2-yl]piperidine-4-carboxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-1-[3-(4-methylphenoxy)pyrazin-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46392089 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-1-[3-(4-methylphenoxy)pyrazin-2-yl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(Oc2nccnc2N2CCC(C(=O)NCc3ccc(N(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H31N5O2/c1-19-4-10-23(11-5-19)33-26-24(27-14-15-28-26)31-16-12-21(13-17-31)25(32)29-18-20-6-8-22(9-7-20)30(2)3/h4-11,14-15,21H,12-13,16-18H2,1-3H3,(H,29,32) |
| InChIKey | LPVRVHSPDVJWDS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|