C29H35N5O2 — CID 50834314
[1-[3-(4-ethylphenoxy)pyrazin-2-yl]piperidin-4-yl]-[4-(4-methylphenyl)piperazin-1-yl]methanone (PubChem CID 50834314) has the molecular formula C29H35N5O2 and a molecular weight of 485.63 g/mol. Its IUPAC name is [1-[3-(4-ethylphenoxy)pyrazin-2-yl]piperidin-4-yl]-[4-(4-methylphenyl)piperazin-1-yl]methanone.
| Compound Name | [1-[3-(4-ethylphenoxy)pyrazin-2-yl]piperidin-4-yl]-[4-(4-methylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 50834314 |
| Molecular Formula | C29H35N5O2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | [1-[3-(4-ethylphenoxy)pyrazin-2-yl]piperidin-4-yl]-[4-(4-methylphenyl)piperazin-1-yl]methanone |
| SMILES | CCc1ccc(Oc2nccnc2N2CCC(C(=O)N3CCN(c4ccc(C)cc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C29H35N5O2/c1-3-23-6-10-26(11-7-23)36-28-27(30-14-15-31-28)33-16-12-24(13-17-33)29(35)34-20-18-32(19-21-34)25-8-4-22(2)5-9-25/h4-11,14-15,24H,3,12-13,16-21H2,1-2H3 |
| InChIKey | HDOLINVKHLDGSK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|