C24H25FN4O2 — CID 50835943
N-(4-fluoro-2-methylphenyl)-1-[3-(4-methylphenoxy)pyrazin-2-yl]piperidine-3-carboxamide (PubChem CID 50835943) has the molecular formula C24H25FN4O2 and a molecular weight of 420.49 g/mol. Its IUPAC name is N-(4-fluoro-2-methylphenyl)-1-[3-(4-methylphenoxy)pyrazin-2-yl]piperidine-3-carboxamide.
| Compound Name | N-(4-fluoro-2-methylphenyl)-1-[3-(4-methylphenoxy)pyrazin-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 50835943 |
| Molecular Formula | C24H25FN4O2 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | N-(4-fluoro-2-methylphenyl)-1-[3-(4-methylphenoxy)pyrazin-2-yl]piperidine-3-carboxamide |
| SMILES | Cc1ccc(Oc2nccnc2N2CCCC(C(=O)Nc3ccc(F)cc3C)C2)cc1 |
| InChI | InChI=1S/C24H25FN4O2/c1-16-5-8-20(9-6-16)31-24-22(26-11-12-27-24)29-13-3-4-18(15-29)23(30)28-21-10-7-19(25)14-17(21)2/h5-12,14,18H,3-4,13,15H2,1-2H3,(H,28,30) |
| InChIKey | KCCRFGKVQWMTOX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |