C23H23BrN4O2 — CID 92897295
(3R)-N-(4-bromo-2-methylphenyl)-1-(3-phenoxypyrazin-2-yl)piperidine-3-carboxamide (PubChem CID 92897295) has the molecular formula C23H23BrN4O2 and a molecular weight of 467.37 g/mol. Its IUPAC name is (3R)-N-(4-bromo-2-methylphenyl)-1-(3-phenoxypyrazin-2-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-(4-bromo-2-methylphenyl)-1-(3-phenoxypyrazin-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92897295 |
| Molecular Formula | C23H23BrN4O2 |
| Molecular Weight | 467.37 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | (3R)-N-(4-bromo-2-methylphenyl)-1-(3-phenoxypyrazin-2-yl)piperidine-3-carboxamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)[C@@H]1CCCN(c2nccnc2Oc2ccccc2)C1 |
| InChI | InChI=1S/C23H23BrN4O2/c1-16-14-18(24)9-10-20(16)27-22(29)17-6-5-13-28(15-17)21-23(26-12-11-25-21)30-19-7-3-2-4-8-19/h2-4,7-12,14,17H,5-6,13,15H2,1H3,(H,27,29)/t17-/m1/s1 |
| InChIKey | XPIOPEMOQRNRIJ-QGZVFWFLSA-N |
| XLogP | 5.19 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.37 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |