C22H21FN4OS — CID 92884301
(3S)-N-(4-fluorophenyl)-1-(3-phenylsulfanylpyrazin-2-yl)piperidine-3-carboxamide (PubChem CID 92884301) has the molecular formula C22H21FN4OS and a molecular weight of 408.50 g/mol. Its IUPAC name is (3S)-N-(4-fluorophenyl)-1-(3-phenylsulfanylpyrazin-2-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-(4-fluorophenyl)-1-(3-phenylsulfanylpyrazin-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92884301 |
| Molecular Formula | C22H21FN4OS |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | (3S)-N-(4-fluorophenyl)-1-(3-phenylsulfanylpyrazin-2-yl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)[C@H]1CCCN(c2nccnc2Sc2ccccc2)C1 |
| InChI | InChI=1S/C22H21FN4OS/c23-17-8-10-18(11-9-17)26-21(28)16-5-4-14-27(15-16)20-22(25-13-12-24-20)29-19-6-2-1-3-7-19/h1-3,6-13,16H,4-5,14-15H2,(H,26,28)/t16-/m0/s1 |
| InChIKey | ULXGEIFRRRQZJM-INIZCTEOSA-N |
| XLogP | 4.62 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |