C23H23FN4OS — CID 46392386
N-(4-fluorophenyl)-1-[3-(3-methylphenyl)sulfanylpyrazin-2-yl]piperidine-3-carboxamide (PubChem CID 46392386) has the molecular formula C23H23FN4OS and a molecular weight of 422.53 g/mol. Its IUPAC name is N-(4-fluorophenyl)-1-[3-(3-methylphenyl)sulfanylpyrazin-2-yl]piperidine-3-carboxamide.
| Compound Name | N-(4-fluorophenyl)-1-[3-(3-methylphenyl)sulfanylpyrazin-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46392386 |
| Molecular Formula | C23H23FN4OS |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-(4-fluorophenyl)-1-[3-(3-methylphenyl)sulfanylpyrazin-2-yl]piperidine-3-carboxamide |
| SMILES | Cc1cccc(Sc2nccnc2N2CCCC(C(=O)Nc3ccc(F)cc3)C2)c1 |
| InChI | InChI=1S/C23H23FN4OS/c1-16-4-2-6-20(14-16)30-23-21(25-11-12-26-23)28-13-3-5-17(15-28)22(29)27-19-9-7-18(24)8-10-19/h2,4,6-12,14,17H,3,5,13,15H2,1H3,(H,27,29) |
| InChIKey | ZYMNALICYHWALO-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |