C22H28N4OS — CID 92884372
(3R)-N-cyclohexyl-1-(3-phenylsulfanylpyrazin-2-yl)piperidine-3-carboxamide (PubChem CID 92884372) has the molecular formula C22H28N4OS and a molecular weight of 396.56 g/mol. Its IUPAC name is (3R)-N-cyclohexyl-1-(3-phenylsulfanylpyrazin-2-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-cyclohexyl-1-(3-phenylsulfanylpyrazin-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92884372 |
| Molecular Formula | C22H28N4OS |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (3R)-N-cyclohexyl-1-(3-phenylsulfanylpyrazin-2-yl)piperidine-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)[C@@H]1CCCN(c2nccnc2Sc2ccccc2)C1 |
| InChI | InChI=1S/C22H28N4OS/c27-21(25-18-9-3-1-4-10-18)17-8-7-15-26(16-17)20-22(24-14-13-23-20)28-19-11-5-2-6-12-19/h2,5-6,11-14,17-18H,1,3-4,7-10,15-16H2,(H,25,27)/t17-/m1/s1 |
| InChIKey | QJGIDUKNAMXPDH-QGZVFWFLSA-N |
| XLogP | 4.29 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |