C12H16ClN3O4 — CID 164525057
methyl 2-[3-chloro-6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridazin-4-yl]acetate (PubChem CID 164525057) has the molecular formula C12H16ClN3O4 and a molecular weight of 301.73 g/mol. Its IUPAC name is methyl 2-[3-chloro-6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridazin-4-yl]acetate.
| Compound Name | methyl 2-[3-chloro-6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridazin-4-yl]acetate |
|---|---|
| PubChem CID | 164525057 |
| Molecular Formula | C12H16ClN3O4 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | methyl 2-[3-chloro-6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridazin-4-yl]acetate |
| SMILES | COC(=O)Cc1cc(NC(=O)OC(C)(C)C)nnc1Cl |
| InChI | InChI=1S/C12H16ClN3O4/c1-12(2,3)20-11(18)14-8-5-7(6-9(17)19-4)10(13)16-15-8/h5H,6H2,1-4H3,(H,14,15,18) |
| InChIKey | WMWCYPZOEHGCSD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |