C11H15F2N3O3 — CID 164537024
tert-butyl N-[6-(difluoromethyl)-5-methoxypyridazin-3-yl]carbamate (PubChem CID 164537024) has the molecular formula C11H15F2N3O3 and a molecular weight of 275.25 g/mol. Its IUPAC name is tert-butyl N-[6-(difluoromethyl)-5-methoxypyridazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[6-(difluoromethyl)-5-methoxypyridazin-3-yl]carbamate |
|---|---|
| PubChem CID | 164537024 |
| Molecular Formula | C11H15F2N3O3 |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | tert-butyl N-[6-(difluoromethyl)-5-methoxypyridazin-3-yl]carbamate |
| SMILES | COc1cc(NC(=O)OC(C)(C)C)nnc1C(F)F |
| InChI | InChI=1S/C11H15F2N3O3/c1-11(2,3)19-10(17)14-7-5-6(18-4)8(9(12)13)16-15-7/h5,9H,1-4H3,(H,14,15,17) |
| InChIKey | PUHDBKUBFCNEMA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |