C14H18N4O3 — CID 139599995
tert-butyl N-[1-(2-methoxyphenyl)triazol-4-yl]carbamate (PubChem CID 139599995) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is tert-butyl N-[1-(2-methoxyphenyl)triazol-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2-methoxyphenyl)triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 139599995 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | tert-butyl N-[1-(2-methoxyphenyl)triazol-4-yl]carbamate |
| SMILES | COc1ccccc1-n1cc(NC(=O)OC(C)(C)C)nn1 |
| InChI | InChI=1S/C14H18N4O3/c1-14(2,3)21-13(19)15-12-9-18(17-16-12)10-7-5-6-8-11(10)20-4/h5-9H,1-4H3,(H,15,19) |
| InChIKey | HTQHQYWASBOPPN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |