C17H19ClN2O3 — CID 91422151
tert-butyl N-[4-chloro-6-(2-methoxyphenyl)-2-pyridinyl]carbamate (PubChem CID 91422151) has the molecular formula C17H19ClN2O3 and a molecular weight of 334.80 g/mol. Its IUPAC name is tert-butyl N-[4-chloro-6-(2-methoxyphenyl)-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[4-chloro-6-(2-methoxyphenyl)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 91422151 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | tert-butyl N-[4-chloro-6-(2-methoxyphenyl)-2-pyridinyl]carbamate |
| SMILES | COc1ccccc1-c1cc(Cl)cc(NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C17H19ClN2O3/c1-17(2,3)23-16(21)20-15-10-11(18)9-13(19-15)12-7-5-6-8-14(12)22-4/h5-10H,1-4H3,(H,19,20,21) |
| InChIKey | WAUHBBORGQEXEI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |