C10H14ClN3O3 — CID 144985934
tert-butyl N-(6-chloro-2-methoxypyrimidin-4-yl)carbamate (PubChem CID 144985934) has the molecular formula C10H14ClN3O3 and a molecular weight of 259.69 g/mol. Its IUPAC name is tert-butyl N-(6-chloro-2-methoxypyrimidin-4-yl)carbamate.
| Compound Name | tert-butyl N-(6-chloro-2-methoxypyrimidin-4-yl)carbamate |
|---|---|
| PubChem CID | 144985934 |
| Molecular Formula | C10H14ClN3O3 |
| Molecular Weight | 259.69 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | tert-butyl N-(6-chloro-2-methoxypyrimidin-4-yl)carbamate |
| SMILES | COc1nc(Cl)cc(NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C10H14ClN3O3/c1-10(2,3)17-9(15)14-7-5-6(11)12-8(13-7)16-4/h5H,1-4H3,(H,12,13,14,15) |
| InChIKey | MJDOZZZOZCTQCD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.69 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |