C18H18ClFN4O3 — CID 171537179
tert-butyl N-[6-chloro-4-(4-fluoro-1-methylindazol-6-yl)oxy-2-pyridinyl]carbamate (PubChem CID 171537179) has the molecular formula C18H18ClFN4O3 and a molecular weight of 392.82 g/mol. Its IUPAC name is tert-butyl N-[6-chloro-4-(4-fluoro-1-methylindazol-6-yl)oxy-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-chloro-4-(4-fluoro-1-methylindazol-6-yl)oxy-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 171537179 |
| Molecular Formula | C18H18ClFN4O3 |
| Molecular Weight | 392.82 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | tert-butyl N-[6-chloro-4-(4-fluoro-1-methylindazol-6-yl)oxy-2-pyridinyl]carbamate |
| SMILES | Cn1ncc2c(F)cc(Oc3cc(Cl)nc(NC(=O)OC(C)(C)C)c3)cc21 |
| InChI | InChI=1S/C18H18ClFN4O3/c1-18(2,3)27-17(25)23-16-8-11(7-15(19)22-16)26-10-5-13(20)12-9-21-24(4)14(12)6-10/h5-9H,1-4H3,(H,22,23,25) |
| InChIKey | QYOMWIJCSQOWRO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.82 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|