C11H15ClN4O5 — CID 123273818
[1-(carboxyamino)-1-(6-chloro-2-methoxypyrimidin-4-yl)-2-methylpropyl]carbamic acid (PubChem CID 123273818) has the molecular formula C11H15ClN4O5 and a molecular weight of 318.72 g/mol. Its IUPAC name is [1-(carboxyamino)-1-(6-chloro-2-methoxypyrimidin-4-yl)-2-methylpropyl]carbamic acid.
| Compound Name | [1-(carboxyamino)-1-(6-chloro-2-methoxypyrimidin-4-yl)-2-methylpropyl]carbamic acid |
|---|---|
| PubChem CID | 123273818 |
| Molecular Formula | C11H15ClN4O5 |
| Molecular Weight | 318.72 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | [1-(carboxyamino)-1-(6-chloro-2-methoxypyrimidin-4-yl)-2-methylpropyl]carbamic acid |
| SMILES | COc1nc(Cl)cc(C(NC(=O)O)(NC(=O)O)C(C)C)n1 |
| InChI | InChI=1S/C11H15ClN4O5/c1-5(2)11(15-9(17)18,16-10(19)20)6-4-7(12)14-8(13-6)21-3/h4-5,15-16H,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | MUZFMUNPBGTFBC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 133.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.72 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|