C9H11ClF2N2O2 — CID 170577357
4-chloro-6-(1,1-difluoroethyl)-2-(2-methoxyethoxy)pyrimidine (PubChem CID 170577357) has the molecular formula C9H11ClF2N2O2 and a molecular weight of 252.65 g/mol. Its IUPAC name is 4-chloro-6-(1,1-difluoroethyl)-2-(2-methoxyethoxy)pyrimidine.
| Compound Name | 4-chloro-6-(1,1-difluoroethyl)-2-(2-methoxyethoxy)pyrimidine |
|---|---|
| PubChem CID | 170577357 |
| Molecular Formula | C9H11ClF2N2O2 |
| Molecular Weight | 252.65 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 4-chloro-6-(1,1-difluoroethyl)-2-(2-methoxyethoxy)pyrimidine |
| SMILES | COCCOc1nc(Cl)cc(C(C)(F)F)n1 |
| InChI | InChI=1S/C9H11ClF2N2O2/c1-9(11,12)6-5-7(10)14-8(13-6)16-4-3-15-2/h5H,3-4H2,1-2H3 |
| InChIKey | YNSFBBRVJHXCMF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.65 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|