C10H10Cl2F2N2O2 — CID 166390326
2-(2,6-dichloro-4-pyridinyl)-2,2-difluoro-N-(2-methoxyethyl)acetamide (PubChem CID 166390326) has the molecular formula C10H10Cl2F2N2O2 and a molecular weight of 299.10 g/mol. Its IUPAC name is 2-(2,6-dichloro-4-pyridinyl)-2,2-difluoro-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-(2,6-dichloro-4-pyridinyl)-2,2-difluoro-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 166390326 |
| Molecular Formula | C10H10Cl2F2N2O2 |
| Molecular Weight | 299.10 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 2-(2,6-dichloro-4-pyridinyl)-2,2-difluoro-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)C(F)(F)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C10H10Cl2F2N2O2/c1-18-3-2-15-9(17)10(13,14)6-4-7(11)16-8(12)5-6/h4-5H,2-3H2,1H3,(H,15,17) |
| InChIKey | PTCFKLBGXHJAFA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.10 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|