C12H13ClF3N3O3S — CID 17433500
2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-N-(2-methoxyethylcarbamoyl)acetamide (PubChem CID 17433500) has the molecular formula C12H13ClF3N3O3S and a molecular weight of 371.77 g/mol. Its IUPAC name is 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-N-(2-methoxyethylcarbamoyl)acetamide.
| Compound Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-N-(2-methoxyethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 17433500 |
| Molecular Formula | C12H13ClF3N3O3S |
| Molecular Weight | 371.77 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-N-(2-methoxyethylcarbamoyl)acetamide |
| SMILES | COCCNC(=O)NC(=O)CSc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H13ClF3N3O3S/c1-22-3-2-17-11(21)19-9(20)6-23-10-8(13)4-7(5-18-10)12(14,15)16/h4-5H,2-3,6H2,1H3,(H2,17,19,20,21) |
| InChIKey | KQFPRPXXQYJEMM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.77 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|