C11H14ClF3N4O2 — CID 114562871
3-[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]-N-(2-methoxyethyl)propanamide (PubChem CID 114562871) has the molecular formula C11H14ClF3N4O2 and a molecular weight of 326.71 g/mol. Its IUPAC name is 3-[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 114562871 |
| Molecular Formula | C11H14ClF3N4O2 |
| Molecular Weight | 326.71 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 3-[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CCNc1cc(C(F)(F)F)nc(Cl)n1 |
| InChI | InChI=1S/C11H14ClF3N4O2/c1-21-5-4-17-9(20)2-3-16-8-6-7(11(13,14)15)18-10(12)19-8/h6H,2-5H2,1H3,(H,17,20)(H,16,18,19) |
| InChIKey | BLHUBEXUUHASMV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.71 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|