C10H13ClF3N3O — CID 114562693
1-[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]-2-methylbutan-2-ol (PubChem CID 114562693) has the molecular formula C10H13ClF3N3O and a molecular weight of 283.68 g/mol. Its IUPAC name is 1-[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]-2-methylbutan-2-ol.
| Compound Name | 1-[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 114562693 |
| Molecular Formula | C10H13ClF3N3O |
| Molecular Weight | 283.68 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 1-[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]-2-methylbutan-2-ol |
| SMILES | CCC(C)(O)CNc1cc(C(F)(F)F)nc(Cl)n1 |
| InChI | InChI=1S/C10H13ClF3N3O/c1-3-9(2,18)5-15-7-4-6(10(12,13)14)16-8(11)17-7/h4,18H,3,5H2,1-2H3,(H,15,16,17) |
| InChIKey | IYNQQSHLEFGAIY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.68 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |