C11H17F3N4O — CID 114565294
2-methyl-1-[[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]butan-2-ol (PubChem CID 114565294) has the molecular formula C11H17F3N4O and a molecular weight of 278.28 g/mol. Its IUPAC name is 2-methyl-1-[[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]butan-2-ol.
| Compound Name | 2-methyl-1-[[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]butan-2-ol |
|---|---|
| PubChem CID | 114565294 |
| Molecular Formula | C11H17F3N4O |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-methyl-1-[[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]butan-2-ol |
| SMILES | CCC(C)(O)CNc1cc(C(F)(F)F)nc(NC)n1 |
| InChI | InChI=1S/C11H17F3N4O/c1-4-10(2,19)6-16-8-5-7(11(12,13)14)17-9(15-3)18-8/h5,19H,4,6H2,1-3H3,(H2,15,16,17,18) |
| InChIKey | DPINVQCCZDKLJB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |