C12H18F3N5O — CID 114565571
N-tert-butyl-2-[[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]acetamide (PubChem CID 114565571) has the molecular formula C12H18F3N5O and a molecular weight of 305.30 g/mol. Its IUPAC name is N-tert-butyl-2-[[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]acetamide |
|---|---|
| PubChem CID | 114565571 |
| Molecular Formula | C12H18F3N5O |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | N-tert-butyl-2-[[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]acetamide |
| SMILES | CNc1nc(NCC(=O)NC(C)(C)C)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H18F3N5O/c1-11(2,3)20-9(21)6-17-8-5-7(12(13,14)15)18-10(16-4)19-8/h5H,6H2,1-4H3,(H,20,21)(H2,16,17,18,19) |
| InChIKey | QVCSOYMKSZKYNT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |