C11H20N6O — CID 113293339
2-[[2-amino-6-(methylamino)pyrimidin-4-yl]amino]-N-tert-butylacetamide (PubChem CID 113293339) has the molecular formula C11H20N6O and a molecular weight of 252.32 g/mol. Its IUPAC name is 2-[[2-amino-6-(methylamino)pyrimidin-4-yl]amino]-N-tert-butylacetamide.
| Compound Name | 2-[[2-amino-6-(methylamino)pyrimidin-4-yl]amino]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 113293339 |
| Molecular Formula | C11H20N6O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 2-[[2-amino-6-(methylamino)pyrimidin-4-yl]amino]-N-tert-butylacetamide |
| SMILES | CNc1cc(NCC(=O)NC(C)(C)C)nc(N)n1 |
| InChI | InChI=1S/C11H20N6O/c1-11(2,3)17-9(18)6-14-8-5-7(13-4)15-10(12)16-8/h5H,6H2,1-4H3,(H,17,18)(H4,12,13,14,15,16) |
| InChIKey | JSTCANAMDVVUBA-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |