C9H11ClF3N3O — CID 114562913
1-[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]butan-2-ol (PubChem CID 114562913) has the molecular formula C9H11ClF3N3O and a molecular weight of 269.65 g/mol. Its IUPAC name is 1-[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]butan-2-ol.
| Compound Name | 1-[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]butan-2-ol |
|---|---|
| PubChem CID | 114562913 |
| Molecular Formula | C9H11ClF3N3O |
| Molecular Weight | 269.65 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 1-[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]butan-2-ol |
| SMILES | CCC(O)CNc1cc(C(F)(F)F)nc(Cl)n1 |
| InChI | InChI=1S/C9H11ClF3N3O/c1-2-5(17)4-14-7-3-6(9(11,12)13)15-8(10)16-7/h3,5,17H,2,4H2,1H3,(H,14,15,16) |
| InChIKey | WOASYHXGOMJNKK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.65 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |