C8H11F3N4O — CID 114564072
1-[[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]amino]propan-2-ol (PubChem CID 114564072) has the molecular formula C8H11F3N4O and a molecular weight of 236.20 g/mol. Its IUPAC name is 1-[[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]amino]propan-2-ol.
| Compound Name | 1-[[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]amino]propan-2-ol |
|---|---|
| PubChem CID | 114564072 |
| Molecular Formula | C8H11F3N4O |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 1-[[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]amino]propan-2-ol |
| SMILES | CC(O)CNc1cc(C(F)(F)F)nc(N)n1 |
| InChI | InChI=1S/C8H11F3N4O/c1-4(16)3-13-6-2-5(8(9,10)11)14-7(12)15-6/h2,4,16H,3H2,1H3,(H3,12,13,14,15) |
| InChIKey | UUCCLFSLIDKZNM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |