C8H8F6N4S — CID 106434004
6-(trifluoromethyl)-4-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidine-2,4-diamine (PubChem CID 106434004) has the molecular formula C8H8F6N4S and a molecular weight of 306.24 g/mol. Its IUPAC name is 6-(trifluoromethyl)-4-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidine-2,4-diamine.
| Compound Name | 6-(trifluoromethyl)-4-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 106434004 |
| Molecular Formula | C8H8F6N4S |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 6-(trifluoromethyl)-4-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidine-2,4-diamine |
| SMILES | Nc1nc(NCCSC(F)(F)F)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H8F6N4S/c9-7(10,11)4-3-5(18-6(15)17-4)16-1-2-19-8(12,13)14/h3H,1-2H2,(H3,15,16,17,18) |
| InChIKey | GCDNATISKBODJI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|