C9H10F6N4O — CID 114565117
4-N-[2-(2,2,2-trifluoroethoxy)ethyl]-6-(trifluoromethyl)pyrimidine-2,4-diamine (PubChem CID 114565117) has the molecular formula C9H10F6N4O and a molecular weight of 304.19 g/mol. Its IUPAC name is 4-N-[2-(2,2,2-trifluoroethoxy)ethyl]-6-(trifluoromethyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-[2-(2,2,2-trifluoroethoxy)ethyl]-6-(trifluoromethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 114565117 |
| Molecular Formula | C9H10F6N4O |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 4-N-[2-(2,2,2-trifluoroethoxy)ethyl]-6-(trifluoromethyl)pyrimidine-2,4-diamine |
| SMILES | Nc1nc(NCCOCC(F)(F)F)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H10F6N4O/c10-8(11,12)4-20-2-1-17-6-3-5(9(13,14)15)18-7(16)19-6/h3H,1-2,4H2,(H3,16,17,18,19) |
| InChIKey | OIIGTMQVAROVPW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|