C9H10F6N4S — CID 106434144
6-hydrazinyl-4-(trifluoromethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]pyridin-2-amine (PubChem CID 106434144) has the molecular formula C9H10F6N4S and a molecular weight of 320.26 g/mol. Its IUPAC name is 6-hydrazinyl-4-(trifluoromethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]pyridin-2-amine.
| Compound Name | 6-hydrazinyl-4-(trifluoromethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 106434144 |
| Molecular Formula | C9H10F6N4S |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 6-hydrazinyl-4-(trifluoromethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]pyridin-2-amine |
| SMILES | NNc1cc(C(F)(F)F)cc(NCCSC(F)(F)F)n1 |
| InChI | InChI=1S/C9H10F6N4S/c10-8(11,12)5-3-6(18-7(4-5)19-16)17-1-2-20-9(13,14)15/h3-4H,1-2,16H2,(H2,17,18,19) |
| InChIKey | XJFFLFQOTYKGPA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|