C8H9Cl2F3N4S — CID 106434145
3,5-dichloro-6-hydrazinyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyridin-2-amine (PubChem CID 106434145) has the molecular formula C8H9Cl2F3N4S and a molecular weight of 321.16 g/mol. Its IUPAC name is 3,5-dichloro-6-hydrazinyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyridin-2-amine.
| Compound Name | 3,5-dichloro-6-hydrazinyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 106434145 |
| Molecular Formula | C8H9Cl2F3N4S |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 3,5-dichloro-6-hydrazinyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyridin-2-amine |
| SMILES | NNc1nc(NCCSC(F)(F)F)c(Cl)cc1Cl |
| InChI | InChI=1S/C8H9Cl2F3N4S/c9-4-3-5(10)7(17-14)16-6(4)15-1-2-18-8(11,12)13/h3H,1-2,14H2,(H2,15,16,17) |
| InChIKey | MNAQCUOUDRLFRY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|