C9H11Cl2F3N4O — CID 102762081
3,5-dichloro-6-hydrazinyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridin-2-amine (PubChem CID 102762081) has the molecular formula C9H11Cl2F3N4O and a molecular weight of 319.11 g/mol. Its IUPAC name is 3,5-dichloro-6-hydrazinyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridin-2-amine.
| Compound Name | 3,5-dichloro-6-hydrazinyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 102762081 |
| Molecular Formula | C9H11Cl2F3N4O |
| Molecular Weight | 319.11 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 3,5-dichloro-6-hydrazinyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridin-2-amine |
| SMILES | NNc1nc(NCCOCC(F)(F)F)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H11Cl2F3N4O/c10-5-3-6(11)8(18-15)17-7(5)16-1-2-19-4-9(12,13)14/h3H,1-2,4,15H2,(H2,16,17,18) |
| InChIKey | GIFPBUJQONOFGX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.11 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|