C10H9Cl2F4NO — CID 83078949
2,6-dichloro-4-fluoro-N-[2-(2,2,2-trifluoroethoxy)ethyl]aniline (PubChem CID 83078949) has the molecular formula C10H9Cl2F4NO and a molecular weight of 306.09 g/mol. Its IUPAC name is 2,6-dichloro-4-fluoro-N-[2-(2,2,2-trifluoroethoxy)ethyl]aniline.
| Compound Name | 2,6-dichloro-4-fluoro-N-[2-(2,2,2-trifluoroethoxy)ethyl]aniline |
|---|---|
| PubChem CID | 83078949 |
| Molecular Formula | C10H9Cl2F4NO |
| Molecular Weight | 306.09 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | 2,6-dichloro-4-fluoro-N-[2-(2,2,2-trifluoroethoxy)ethyl]aniline |
| SMILES | Fc1cc(Cl)c(NCCOCC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C10H9Cl2F4NO/c11-7-3-6(13)4-8(12)9(7)17-1-2-18-5-10(14,15)16/h3-4,17H,1-2,5H2 |
| InChIKey | GPHFHKXDWNMPQZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.09 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|