C11H10ClF6NO — CID 61492678
2-chloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]-6-(trifluoromethyl)aniline (PubChem CID 61492678) has the molecular formula C11H10ClF6NO and a molecular weight of 321.65 g/mol. Its IUPAC name is 2-chloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]-6-(trifluoromethyl)aniline.
| Compound Name | 2-chloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]-6-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 61492678 |
| Molecular Formula | C11H10ClF6NO |
| Molecular Weight | 321.65 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 2-chloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]-6-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)COCCNc1c(Cl)cccc1C(F)(F)F |
| InChI | InChI=1S/C11H10ClF6NO/c12-8-3-1-2-7(11(16,17)18)9(8)19-4-5-20-6-10(13,14)15/h1-3,19H,4-6H2 |
| InChIKey | MWGPMXRJENVHHS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.65 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|