C10H10ClF3N2O — CID 43152515
3-[2-chloro-6-(trifluoromethyl)anilino]propanamide (PubChem CID 43152515) has the molecular formula C10H10ClF3N2O and a molecular weight of 266.65 g/mol. Its IUPAC name is 3-[2-chloro-6-(trifluoromethyl)anilino]propanamide.
| Compound Name | 3-[2-chloro-6-(trifluoromethyl)anilino]propanamide |
|---|---|
| PubChem CID | 43152515 |
| Molecular Formula | C10H10ClF3N2O |
| Molecular Weight | 266.65 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 3-[2-chloro-6-(trifluoromethyl)anilino]propanamide |
| SMILES | NC(=O)CCNc1c(Cl)cccc1C(F)(F)F |
| InChI | InChI=1S/C10H10ClF3N2O/c11-7-3-1-2-6(10(12,13)14)9(7)16-5-4-8(15)17/h1-3,16H,4-5H2,(H2,15,17) |
| InChIKey | QYKUVZKJEAGOKX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.65 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |