C12H13ClF3NO2 — CID 79204589
N-[2-chloro-6-(trifluoromethyl)phenyl]-4-hydroxypentanamide (PubChem CID 79204589) has the molecular formula C12H13ClF3NO2 and a molecular weight of 295.69 g/mol. Its IUPAC name is N-[2-chloro-6-(trifluoromethyl)phenyl]-4-hydroxypentanamide.
| Compound Name | N-[2-chloro-6-(trifluoromethyl)phenyl]-4-hydroxypentanamide |
|---|---|
| PubChem CID | 79204589 |
| Molecular Formula | C12H13ClF3NO2 |
| Molecular Weight | 295.69 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | N-[2-chloro-6-(trifluoromethyl)phenyl]-4-hydroxypentanamide |
| SMILES | CC(O)CCC(=O)Nc1c(Cl)cccc1C(F)(F)F |
| InChI | InChI=1S/C12H13ClF3NO2/c1-7(18)5-6-10(19)17-11-8(12(14,15)16)3-2-4-9(11)13/h2-4,7,18H,5-6H2,1H3,(H,17,19) |
| InChIKey | BARQFKKMYQDNCS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.69 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |