C17H14ClF4NOS — CID 55583835
N-[2-chloro-6-(trifluoromethyl)phenyl]-2-[1-(4-fluorophenyl)ethylsulfanyl]acetamide (PubChem CID 55583835) has the molecular formula C17H14ClF4NOS and a molecular weight of 391.82 g/mol. Its IUPAC name is N-[2-chloro-6-(trifluoromethyl)phenyl]-2-[1-(4-fluorophenyl)ethylsulfanyl]acetamide.
| Compound Name | N-[2-chloro-6-(trifluoromethyl)phenyl]-2-[1-(4-fluorophenyl)ethylsulfanyl]acetamide |
|---|---|
| PubChem CID | 55583835 |
| Molecular Formula | C17H14ClF4NOS |
| Molecular Weight | 391.82 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | N-[2-chloro-6-(trifluoromethyl)phenyl]-2-[1-(4-fluorophenyl)ethylsulfanyl]acetamide |
| SMILES | CC(SCC(=O)Nc1c(Cl)cccc1C(F)(F)F)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H14ClF4NOS/c1-10(11-5-7-12(19)8-6-11)25-9-15(24)23-16-13(17(20,21)22)3-2-4-14(16)18/h2-8,10H,9H2,1H3,(H,23,24) |
| InChIKey | GRWBYCOMYBKWPF-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.82 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |