C20H23FN2O3S2 — CID 60540977
2-[1-(4-fluorophenyl)ethylsulfanyl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide (PubChem CID 60540977) has the molecular formula C20H23FN2O3S2 and a molecular weight of 422.55 g/mol. Its IUPAC name is 2-[1-(4-fluorophenyl)ethylsulfanyl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[1-(4-fluorophenyl)ethylsulfanyl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 60540977 |
| Molecular Formula | C20H23FN2O3S2 |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 2-[1-(4-fluorophenyl)ethylsulfanyl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
| SMILES | CC(SCC(=O)Nc1cccc(S(=O)(=O)N2CCCC2)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H23FN2O3S2/c1-15(16-7-9-17(21)10-8-16)27-14-20(24)22-18-5-4-6-19(13-18)28(25,26)23-11-2-3-12-23/h4-10,13,15H,2-3,11-12,14H2,1H3,(H,22,24) |
| InChIKey | CPOIJJDIYMIVDO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |