C19H21FN2O3S2 — CID 9414940
3-(4-fluorophenyl)sulfanyl-N-(3-pyrrolidin-1-ylsulfonylphenyl)propanamide (PubChem CID 9414940) has the molecular formula C19H21FN2O3S2 and a molecular weight of 408.52 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfanyl-N-(3-pyrrolidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | 3-(4-fluorophenyl)sulfanyl-N-(3-pyrrolidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 9414940 |
| Molecular Formula | C19H21FN2O3S2 |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 3-(4-fluorophenyl)sulfanyl-N-(3-pyrrolidin-1-ylsulfonylphenyl)propanamide |
| SMILES | O=C(CCSc1ccc(F)cc1)Nc1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C19H21FN2O3S2/c20-15-6-8-17(9-7-15)26-13-10-19(23)21-16-4-3-5-18(14-16)27(24,25)22-11-1-2-12-22/h3-9,14H,1-2,10-13H2,(H,21,23) |
| InChIKey | GMCPMSGBYHYGLO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |