C20H23FN2O3S — CID 110312103
4-(4-fluorophenyl)-N-(3-pyrrolidin-1-ylsulfonylphenyl)butanamide (PubChem CID 110312103) has the molecular formula C20H23FN2O3S and a molecular weight of 390.48 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-(3-pyrrolidin-1-ylsulfonylphenyl)butanamide.
| Compound Name | 4-(4-fluorophenyl)-N-(3-pyrrolidin-1-ylsulfonylphenyl)butanamide |
|---|---|
| PubChem CID | 110312103 |
| Molecular Formula | C20H23FN2O3S |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 4-(4-fluorophenyl)-N-(3-pyrrolidin-1-ylsulfonylphenyl)butanamide |
| SMILES | O=C(CCCc1ccc(F)cc1)Nc1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C20H23FN2O3S/c21-17-11-9-16(10-12-17)5-3-8-20(24)22-18-6-4-7-19(15-18)27(25,26)23-13-1-2-14-23/h4,6-7,9-12,15H,1-3,5,8,13-14H2,(H,22,24) |
| InChIKey | FBTCXTRRSYKUAW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |