C16H15ClF3N3O4 — CID 16510606
2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)-N-[2-chloro-6-(trifluoromethyl)phenyl]acetamide (PubChem CID 16510606) has the molecular formula C16H15ClF3N3O4 and a molecular weight of 405.76 g/mol. Its IUPAC name is 2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)-N-[2-chloro-6-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)-N-[2-chloro-6-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 16510606 |
| Molecular Formula | C16H15ClF3N3O4 |
| Molecular Weight | 405.76 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | 2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)-N-[2-chloro-6-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCCCN1C(=O)C(=O)N(CC(=O)Nc2c(Cl)cccc2C(F)(F)F)C1=O |
| InChI | InChI=1S/C16H15ClF3N3O4/c1-2-3-7-22-13(25)14(26)23(15(22)27)8-11(24)21-12-9(16(18,19)20)5-4-6-10(12)17/h4-6H,2-3,7-8H2,1H3,(H,21,24) |
| InChIKey | XLSKFSZWALGCEH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.76 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|