C12H14ClF3N2O — CID 65225587
2-(aminomethyl)-N-[2-chloro-6-(trifluoromethyl)phenyl]butanamide (PubChem CID 65225587) has the molecular formula C12H14ClF3N2O and a molecular weight of 294.70 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[2-chloro-6-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 2-(aminomethyl)-N-[2-chloro-6-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 65225587 |
| Molecular Formula | C12H14ClF3N2O |
| Molecular Weight | 294.70 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-(aminomethyl)-N-[2-chloro-6-(trifluoromethyl)phenyl]butanamide |
| SMILES | CCC(CN)C(=O)Nc1c(Cl)cccc1C(F)(F)F |
| InChI | InChI=1S/C12H14ClF3N2O/c1-2-7(6-17)11(19)18-10-8(12(14,15)16)4-3-5-9(10)13/h3-5,7H,2,6,17H2,1H3,(H,18,19) |
| InChIKey | KEGYWVCYNUJJDL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.70 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |