C8H10ClF3N4O2S2 — CID 106429802
5-chloro-6-hydrazinyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-3-sulfonamide (PubChem CID 106429802) has the molecular formula C8H10ClF3N4O2S2 and a molecular weight of 350.78 g/mol. Its IUPAC name is 5-chloro-6-hydrazinyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-hydrazinyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106429802 |
| Molecular Formula | C8H10ClF3N4O2S2 |
| Molecular Weight | 350.78 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 5-chloro-6-hydrazinyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-3-sulfonamide |
| SMILES | NNc1ncc(S(=O)(=O)NCCSC(F)(F)F)cc1Cl |
| InChI | InChI=1S/C8H10ClF3N4O2S2/c9-6-3-5(4-14-7(6)16-13)20(17,18)15-1-2-19-8(10,11)12/h3-4,15H,1-2,13H2,(H,14,16) |
| InChIKey | LPKIJKRTCYWYED-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.78 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|