C12H19Cl2N5O — CID 102762551
3-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-N,N-diethylpropanamide (PubChem CID 102762551) has the molecular formula C12H19Cl2N5O and a molecular weight of 320.22 g/mol. Its IUPAC name is 3-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-N,N-diethylpropanamide.
| Compound Name | 3-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 102762551 |
| Molecular Formula | C12H19Cl2N5O |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 3-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCNc1nc(NN)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H19Cl2N5O/c1-3-19(4-2)10(20)5-6-16-11-8(13)7-9(14)12(17-11)18-15/h7H,3-6,15H2,1-2H3,(H2,16,17,18) |
| InChIKey | WPQCERFRVMHBIC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|