C13H18ClFN2O — CID 109030627
3-(3-chloro-4-fluoroanilino)-N,N-diethylpropanamide (PubChem CID 109030627) has the molecular formula C13H18ClFN2O and a molecular weight of 272.75 g/mol. Its IUPAC name is 3-(3-chloro-4-fluoroanilino)-N,N-diethylpropanamide.
| Compound Name | 3-(3-chloro-4-fluoroanilino)-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 109030627 |
| Molecular Formula | C13H18ClFN2O |
| Molecular Weight | 272.75 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 3-(3-chloro-4-fluoroanilino)-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCNc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H18ClFN2O/c1-3-17(4-2)13(18)7-8-16-10-5-6-12(15)11(14)9-10/h5-6,9,16H,3-4,7-8H2,1-2H3 |
| InChIKey | ATFCISDKFMRQAP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.75 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |